C12H17N3O2 — CID 144847529
2-methanimidoyl-5-(oxan-4-yloxy)benzene-1,4-diamine (PubChem CID 144847529) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 2-methanimidoyl-5-(oxan-4-yloxy)benzene-1,4-diamine.
| Compound Name | 2-methanimidoyl-5-(oxan-4-yloxy)benzene-1,4-diamine |
|---|---|
| PubChem CID | 144847529 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 2-methanimidoyl-5-(oxan-4-yloxy)benzene-1,4-diamine |
| SMILES | [H]/N=C/c1cc(N)c(OC2CCOCC2)cc1N |
| InChI | InChI=1S/C12H17N3O2/c13-7-8-5-11(15)12(6-10(8)14)17-9-1-3-16-4-2-9/h5-7,9,13H,1-4,14-15H2/b13-7+ |
| InChIKey | UWBOVQOQHMRWSQ-NTUHNPAUSA-N |
| XLogP | 1.41 |
| TPSA | 94.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|