C14H15N3O2 — CID 171644841
4-cyclopropyl-2-methanimidoyl-5-(1,2-oxazol-3-ylmethoxy)aniline (PubChem CID 171644841) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is 4-cyclopropyl-2-methanimidoyl-5-(1,2-oxazol-3-ylmethoxy)aniline.
| Compound Name | 4-cyclopropyl-2-methanimidoyl-5-(1,2-oxazol-3-ylmethoxy)aniline |
|---|---|
| PubChem CID | 171644841 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 4-cyclopropyl-2-methanimidoyl-5-(1,2-oxazol-3-ylmethoxy)aniline |
| SMILES | [H]/N=C/c1cc(C2CC2)c(OCc2ccon2)cc1N |
| InChI | InChI=1S/C14H15N3O2/c15-7-10-5-12(9-1-2-9)14(6-13(10)16)18-8-11-3-4-19-17-11/h3-7,9,15H,1-2,8,16H2/b15-7+ |
| InChIKey | ORKXSHFXEQJOLR-VIZOYTHASA-N |
| XLogP | 2.71 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|