C10H22O2Si — CID 123348766
(1,2-dimethylcyclobutyl)-diethoxysilane (PubChem CID 123348766) has the molecular formula C10H22O2Si and a molecular weight of 202.37 g/mol. Its IUPAC name is (1,2-dimethylcyclobutyl)-diethoxysilane.
| Compound Name | (1,2-dimethylcyclobutyl)-diethoxysilane |
|---|---|
| PubChem CID | 123348766 |
| Molecular Formula | C10H22O2Si |
| Molecular Weight | 202.37 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | (1,2-dimethylcyclobutyl)-diethoxysilane |
| SMILES | CCO[SiH](OCC)C1(C)CCC1C |
| InChI | InChI=1S/C10H22O2Si/c1-5-11-13(12-6-2)10(4)8-7-9(10)3/h9,13H,5-8H2,1-4H3 |
| InChIKey | JUIKOTIDJPYDNV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|