C18H36O2Si — CID 173197530
[1-(3,5-dimethylcyclohexyl)cyclohexyl]-diethoxysilane (PubChem CID 173197530) has the molecular formula C18H36O2Si and a molecular weight of 312.57 g/mol. Its IUPAC name is [1-(3,5-dimethylcyclohexyl)cyclohexyl]-diethoxysilane.
| Compound Name | [1-(3,5-dimethylcyclohexyl)cyclohexyl]-diethoxysilane |
|---|---|
| PubChem CID | 173197530 |
| Molecular Formula | C18H36O2Si |
| Molecular Weight | 312.57 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | [1-(3,5-dimethylcyclohexyl)cyclohexyl]-diethoxysilane |
| SMILES | CCO[SiH](OCC)C1(C2CC(C)CC(C)C2)CCCCC1 |
| InChI | InChI=1S/C18H36O2Si/c1-5-19-21(20-6-2)18(10-8-7-9-11-18)17-13-15(3)12-16(4)14-17/h15-17,21H,5-14H2,1-4H3 |
| InChIKey | BHHCYISZTBDOPV-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.57 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|