C21H41N — CID 123350713
(Z)-3,7-diethyl-N,2,6-trimethyl-5-pentan-2-ylnon-5-en-4-imine (PubChem CID 123350713) has the molecular formula C21H41N and a molecular weight of 307.57 g/mol. Its IUPAC name is (Z)-3,7-diethyl-N,2,6-trimethyl-5-pentan-2-ylnon-5-en-4-imine.
| Compound Name | (Z)-3,7-diethyl-N,2,6-trimethyl-5-pentan-2-ylnon-5-en-4-imine |
|---|---|
| PubChem CID | 123350713 |
| Molecular Formula | C21H41N |
| Molecular Weight | 307.57 g/mol |
| Exact Mass | 307.32 |
| IUPAC Name | (Z)-3,7-diethyl-N,2,6-trimethyl-5-pentan-2-ylnon-5-en-4-imine |
| SMILES | CCCC(C)C(=C(\C)C(CC)CC)/C(=N/C)C(CC)C(C)C |
| InChI | InChI=1S/C21H41N/c1-10-14-16(7)20(17(8)18(11-2)12-3)21(22-9)19(13-4)15(5)6/h15-16,18-19H,10-14H2,1-9H3/b20-17-,22-21+ |
| InChIKey | SYXDHRLDYFKKFZ-JLQYDAKZSA-N |
| XLogP | 6.93 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.57 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|