C20H39N — CID 123714871
(Z)-3,7-diethyl-N,6-dimethyl-5-pentan-2-ylnon-5-en-4-imine (PubChem CID 123714871) has the molecular formula C20H39N and a molecular weight of 293.54 g/mol. Its IUPAC name is (Z)-3,7-diethyl-N,6-dimethyl-5-pentan-2-ylnon-5-en-4-imine.
| Compound Name | (Z)-3,7-diethyl-N,6-dimethyl-5-pentan-2-ylnon-5-en-4-imine |
|---|---|
| PubChem CID | 123714871 |
| Molecular Formula | C20H39N |
| Molecular Weight | 293.54 g/mol |
| Exact Mass | 293.31 |
| IUPAC Name | (Z)-3,7-diethyl-N,6-dimethyl-5-pentan-2-ylnon-5-en-4-imine |
| SMILES | CCCC(C)C(=C(\C)C(CC)CC)/C(=N/C)C(CC)CC |
| InChI | InChI=1S/C20H39N/c1-9-14-15(6)19(16(7)17(10-2)11-3)20(21-8)18(12-4)13-5/h15,17-18H,9-14H2,1-8H3/b19-16-,21-20+ |
| InChIKey | OJRFUCOKNAMRIT-RGWYIFMJSA-N |
| XLogP | 6.68 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.54 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|