C22H37N — CID 123809633
(2E)-5-cyclobutyl-N,7-dimethyl-2-(3-propylcyclobutyl)nona-2,5-dien-4-imine (PubChem CID 123809633) has the molecular formula C22H37N and a molecular weight of 315.55 g/mol. Its IUPAC name is (2E)-5-cyclobutyl-N,7-dimethyl-2-(3-propylcyclobutyl)nona-2,5-dien-4-imine.
| Compound Name | (2E)-5-cyclobutyl-N,7-dimethyl-2-(3-propylcyclobutyl)nona-2,5-dien-4-imine |
|---|---|
| PubChem CID | 123809633 |
| Molecular Formula | C22H37N |
| Molecular Weight | 315.55 g/mol |
| Exact Mass | 315.29 |
| IUPAC Name | (2E)-5-cyclobutyl-N,7-dimethyl-2-(3-propylcyclobutyl)nona-2,5-dien-4-imine |
| SMILES | CCCC1CC(/C(C)=C/C(=N/C)C(=CC(C)CC)C2CCC2)C1 |
| InChI | InChI=1S/C22H37N/c1-6-9-18-14-20(15-18)17(4)13-22(23-5)21(12-16(3)7-2)19-10-8-11-19/h12-13,16,18-20H,6-11,14-15H2,1-5H3/b17-13+,21-12?,23-22- |
| InChIKey | OOCWLMZZLZPZLJ-DNXSTVLJSA-N |
| XLogP | 6.60 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.55 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|