C20H35N — CID 123769432
1-(2-methylcyclobutyl)-N-[3-methyl-4-(3-methyl-3-propylcyclobutyl)but-3-enyl]ethanimine (PubChem CID 123769432) has the molecular formula C20H35N and a molecular weight of 289.51 g/mol. Its IUPAC name is 1-(2-methylcyclobutyl)-N-[3-methyl-4-(3-methyl-3-propylcyclobutyl)but-3-enyl]ethanimine.
| Compound Name | 1-(2-methylcyclobutyl)-N-[3-methyl-4-(3-methyl-3-propylcyclobutyl)but-3-enyl]ethanimine |
|---|---|
| PubChem CID | 123769432 |
| Molecular Formula | C20H35N |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.28 |
| IUPAC Name | 1-(2-methylcyclobutyl)-N-[3-methyl-4-(3-methyl-3-propylcyclobutyl)but-3-enyl]ethanimine |
| SMILES | CCCC1(C)CC(C=C(C)CC/N=C(\C)C2CCC2C)C1 |
| InChI | InChI=1S/C20H35N/c1-6-10-20(5)13-18(14-20)12-15(2)9-11-21-17(4)19-8-7-16(19)3/h12,16,18-19H,6-11,13-14H2,1-5H3/b15-12?,21-17+ |
| InChIKey | IXYPGPIFHUCTOJ-KFYHXSGKSA-N |
| XLogP | 6.05 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|