C23H41N — CID 174326854
N-ethyl-3,5-dimethyl-7-[2-(2-methylcyclobutyl)cyclobutyl]dec-5-en-4-imine (PubChem CID 174326854) has the molecular formula C23H41N and a molecular weight of 331.59 g/mol. Its IUPAC name is N-ethyl-3,5-dimethyl-7-[2-(2-methylcyclobutyl)cyclobutyl]dec-5-en-4-imine.
| Compound Name | N-ethyl-3,5-dimethyl-7-[2-(2-methylcyclobutyl)cyclobutyl]dec-5-en-4-imine |
|---|---|
| PubChem CID | 174326854 |
| Molecular Formula | C23H41N |
| Molecular Weight | 331.59 g/mol |
| Exact Mass | 331.32 |
| IUPAC Name | N-ethyl-3,5-dimethyl-7-[2-(2-methylcyclobutyl)cyclobutyl]dec-5-en-4-imine |
| SMILES | CCCC(C=C(C)/C(=N/CC)C(C)CC)C1CCC1C1CCC1C |
| InChI | InChI=1S/C23H41N/c1-7-10-19(15-18(6)23(24-9-3)16(4)8-2)21-13-14-22(21)20-12-11-17(20)5/h15-17,19-22H,7-14H2,1-6H3/b18-15?,24-23+ |
| InChIKey | CFKDVBDRTGNJAP-XDLLLLLISA-N |
| XLogP | 6.93 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.59 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|