C14H38O3Si4 — CID 123351404
[1,1-bis(dimethylsilyloxy)-1-silyloctan-2-yl]oxy-dimethylsilane (PubChem CID 123351404) has the molecular formula C14H38O3Si4 and a molecular weight of 366.80 g/mol. Its IUPAC name is [1,1-bis(dimethylsilyloxy)-1-silyloctan-2-yl]oxy-dimethylsilane.
| Compound Name | [1,1-bis(dimethylsilyloxy)-1-silyloctan-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 123351404 |
| Molecular Formula | C14H38O3Si4 |
| Molecular Weight | 366.80 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | [1,1-bis(dimethylsilyloxy)-1-silyloctan-2-yl]oxy-dimethylsilane |
| SMILES | CCCCCCC(O[SiH](C)C)C([SiH3])(O[SiH](C)C)O[SiH](C)C |
| InChI | InChI=1S/C14H38O3Si4/c1-8-9-10-11-12-13(15-19(2)3)14(18,16-20(4)5)17-21(6)7/h13,19-21H,8-12H2,1-7,18H3 |
| InChIKey | QCJROBSPRLUGHG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.80 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|