4-[tert-butyl(3,3-dimethylbutyl)amino]-4-oxobut-2-enoic acid

C14H25NO3 — CID 123351536

IUPAC4-[tert-butyl(3,3-dimethylbutyl)amino]-4-oxobut-2-enoic acid
SMILESCC(C)(C)CCN(C(=O)C=CC(=O)O)C(C)(C)C
InChIInChI=1S/C14H25NO3/c1-13(2,3)9-10-15(14(4,5)6)11(16)7-8-12(17)18/h7-8H,9-10H2,1-6H3,(H,17,18)
InChIKeyLPYIWZPQMCLMRM-UHFFFAOYSA-N
MW255.36 g/mol
LogP2.69
Rot. Bonds4

About 4-[tert-butyl(3,3-dimethylbutyl)amino]-4-oxobut-2-enoic acid

4-[tert-butyl(3,3-dimethylbutyl)amino]-4-oxobut-2-enoic acid (PubChem CID 123351536) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is 4-[tert-butyl(3,3-dimethylbutyl)amino]-4-oxobut-2-enoic acid.

Molecular Properties

Compound Name4-[tert-butyl(3,3-dimethylbutyl)amino]-4-oxobut-2-enoic acid
PubChem CID123351536
Molecular FormulaC14H25NO3
Molecular Weight255.36 g/mol
Exact Mass255.18
IUPAC Name4-[tert-butyl(3,3-dimethylbutyl)amino]-4-oxobut-2-enoic acid
SMILESCC(C)(C)CCN(C(=O)C=CC(=O)O)C(C)(C)C
InChIInChI=1S/C14H25NO3/c1-13(2,3)9-10-15(14(4,5)6)11(16)7-8-12(17)18/h7-8H,9-10H2,1-6H3,(H,17,18)
InChIKeyLPYIWZPQMCLMRM-UHFFFAOYSA-N
XLogP2.69
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.36
LogP ≤ 52.69
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 4-[tert-butyl(3,3-dimethylbutyl)amino]-4-oxobut-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[tert-butyl(3,3-dimethylbutyl)amino]-4-oxobut-2-enoic acid?
The IUPAC name of 4-[tert-butyl(3,3-dimethylbutyl)amino]-4-oxobut-2-enoic acid (CID 123351536) is 4-[tert-butyl(3,3-dimethylbutyl)amino]-4-oxobut-2-enoic acid.
What is the SMILES notation for 4-[tert-butyl(3,3-dimethylbutyl)amino]-4-oxobut-2-enoic acid?
The canonical SMILES for 4-[tert-butyl(3,3-dimethylbutyl)amino]-4-oxobut-2-enoic acid is CC(C)(C)CCN(C(=O)C=CC(=O)O)C(C)(C)C.
What is the InChIKey of 4-[tert-butyl(3,3-dimethylbutyl)amino]-4-oxobut-2-enoic acid?
The InChIKey is LPYIWZPQMCLMRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO3/c1-13(2,3)9-10-15(14(4,5)6)11(16)7-8-12(17)18/h7-8H,9-10H2,1-6H3,(H,17,18).
What are the key properties of 4-[tert-butyl(3,3-dimethylbutyl)amino]-4-oxobut-2-enoic acid?
4-[tert-butyl(3,3-dimethylbutyl)amino]-4-oxobut-2-enoic acid has a molecular weight of 255.36 g/mol, XLogP of 2.69, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[tert-butyl(3,3-dimethylbutyl)amino]-4-oxobut-2-enoic acid is sourced from PubChem (CID 123351536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).