C17H34N2O2 — CID 171092778
3-amino-N-tert-butyl-N-(3,3-dimethylbutyl)-5-methyl-6-oxohexanamide (PubChem CID 171092778) has the molecular formula C17H34N2O2 and a molecular weight of 298.47 g/mol. Its IUPAC name is 3-amino-N-tert-butyl-N-(3,3-dimethylbutyl)-5-methyl-6-oxohexanamide.
| Compound Name | 3-amino-N-tert-butyl-N-(3,3-dimethylbutyl)-5-methyl-6-oxohexanamide |
|---|---|
| PubChem CID | 171092778 |
| Molecular Formula | C17H34N2O2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.26 |
| IUPAC Name | 3-amino-N-tert-butyl-N-(3,3-dimethylbutyl)-5-methyl-6-oxohexanamide |
| SMILES | CC(C=O)CC(N)CC(=O)N(CCC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C17H34N2O2/c1-13(12-20)10-14(18)11-15(21)19(17(5,6)7)9-8-16(2,3)4/h12-14H,8-11,18H2,1-7H3 |
| InChIKey | CBRKRXHYIOIGKP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|