C21H38N2O3 — CID 134922712
(2S,3S)-N-tert-butyl-1-(2,2-diethylbutanoyl)-3-methyl-2-(3-oxopropyl)pyrrolidine-3-carboxamide (PubChem CID 134922712) has the molecular formula C21H38N2O3 and a molecular weight of 366.55 g/mol. Its IUPAC name is (2S,3S)-N-tert-butyl-1-(2,2-diethylbutanoyl)-3-methyl-2-(3-oxopropyl)pyrrolidine-3-carboxamide.
| Compound Name | (2S,3S)-N-tert-butyl-1-(2,2-diethylbutanoyl)-3-methyl-2-(3-oxopropyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 134922712 |
| Molecular Formula | C21H38N2O3 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.29 |
| IUPAC Name | (2S,3S)-N-tert-butyl-1-(2,2-diethylbutanoyl)-3-methyl-2-(3-oxopropyl)pyrrolidine-3-carboxamide |
| SMILES | CCC(CC)(CC)C(=O)N1CC[C@](C)(C(=O)NC(C)(C)C)[C@@H]1CCC=O |
| InChI | InChI=1S/C21H38N2O3/c1-8-21(9-2,10-3)18(26)23-14-13-20(7,16(23)12-11-15-24)17(25)22-19(4,5)6/h15-16H,8-14H2,1-7H3,(H,22,25)/t16-,20-/m0/s1 |
| InChIKey | IFAUKQYSIDOKNY-JXFKEZNVSA-N |
| XLogP | 3.70 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|