C23H43N3O3 — CID 167083068
2-[(5-amino-3,3,5-trimethylhexanoyl)amino]-N-(2,4,4-trimethyl-6-oxohexan-2-yl)cyclobutane-1-carboxamide (PubChem CID 167083068) has the molecular formula C23H43N3O3 and a molecular weight of 409.62 g/mol. Its IUPAC name is 2-[(5-amino-3,3,5-trimethylhexanoyl)amino]-N-(2,4,4-trimethyl-6-oxohexan-2-yl)cyclobutane-1-carboxamide.
| Compound Name | 2-[(5-amino-3,3,5-trimethylhexanoyl)amino]-N-(2,4,4-trimethyl-6-oxohexan-2-yl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 167083068 |
| Molecular Formula | C23H43N3O3 |
| Molecular Weight | 409.62 g/mol |
| Exact Mass | 409.33 |
| IUPAC Name | 2-[(5-amino-3,3,5-trimethylhexanoyl)amino]-N-(2,4,4-trimethyl-6-oxohexan-2-yl)cyclobutane-1-carboxamide |
| SMILES | CC(C)(N)CC(C)(C)CC(=O)NC1CCC1C(=O)NC(C)(C)CC(C)(C)CC=O |
| InChI | InChI=1S/C23H43N3O3/c1-20(2,11-12-27)15-23(7,8)26-19(29)16-9-10-17(16)25-18(28)13-21(3,4)14-22(5,6)24/h12,16-17H,9-11,13-15,24H2,1-8H3,(H,25,28)(H,26,29) |
| InChIKey | UPEVAMZENRLHMI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.62 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|