C10H11N — CID 123352229
6-methyl-4a,5-dihydroquinoline (PubChem CID 123352229) has the molecular formula C10H11N and a molecular weight of 145.20 g/mol. Its IUPAC name is 6-methyl-4a,5-dihydroquinoline.
| Compound Name | 6-methyl-4a,5-dihydroquinoline |
|---|---|
| PubChem CID | 123352229 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 6-methyl-4a,5-dihydroquinoline |
| SMILES | CC1=CC=C2N=CC=CC2C1 |
| InChI | InChI=1S/C10H11N/c1-8-4-5-10-9(7-8)3-2-6-11-10/h2-6,9H,7H2,1H3 |
| InChIKey | SPHZUICFJPNVPR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |