C18H18N4O — CID 123352903
1-(3-methyl-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),4,7,9,11,15,17-heptaen-13-yl)ethanone (PubChem CID 123352903) has the molecular formula C18H18N4O and a molecular weight of 306.37 g/mol. Its IUPAC name is 1-(3-methyl-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),4,7,9,11,15,17-heptaen-13-yl)ethanone.
| Compound Name | 1-(3-methyl-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),4,7,9,11,15,17-heptaen-13-yl)ethanone |
|---|---|
| PubChem CID | 123352903 |
| Molecular Formula | C18H18N4O |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 1-(3-methyl-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),4,7,9,11,15,17-heptaen-13-yl)ethanone |
| SMILES | CC(=O)N1Cc2ccccc2C2C(N=NN2C)c2ccccc21 |
| InChI | InChI=1S/C18H18N4O/c1-12(23)22-11-13-7-3-4-8-14(13)18-17(19-20-21(18)2)15-9-5-6-10-16(15)22/h3-10,17-18H,11H2,1-2H3 |
| InChIKey | MSVUREBDINGLGC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 48.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |