C22H26N4O — CID 134565139
1-(5-tert-butyl-6-methyl-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),3,7,9,11,15,17-heptaen-13-yl)ethanone (PubChem CID 134565139) has the molecular formula C22H26N4O and a molecular weight of 362.48 g/mol. Its IUPAC name is 1-(5-tert-butyl-6-methyl-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),3,7,9,11,15,17-heptaen-13-yl)ethanone.
| Compound Name | 1-(5-tert-butyl-6-methyl-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),3,7,9,11,15,17-heptaen-13-yl)ethanone |
|---|---|
| PubChem CID | 134565139 |
| Molecular Formula | C22H26N4O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 1-(5-tert-butyl-6-methyl-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),3,7,9,11,15,17-heptaen-13-yl)ethanone |
| SMILES | CC(=O)N1Cc2ccccc2C2N=NN(C(C)(C)C)C2(C)c2ccccc21 |
| InChI | InChI=1S/C22H26N4O/c1-15(27)25-14-16-10-6-7-11-17(16)20-22(5,18-12-8-9-13-19(18)25)26(24-23-20)21(2,3)4/h6-13,20H,14H2,1-5H3 |
| InChIKey | UPVBZQURUFVDDP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 48.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |