C12H21N — CID 123354145
4-hexylcyclohex-2-en-1-imine (PubChem CID 123354145) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is 4-hexylcyclohex-2-en-1-imine.
| Compound Name | 4-hexylcyclohex-2-en-1-imine |
|---|---|
| PubChem CID | 123354145 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 4-hexylcyclohex-2-en-1-imine |
| SMILES | [H]/N=C1/C=CC(CCCCCC)CC1 |
| InChI | InChI=1S/C12H21N/c1-2-3-4-5-6-11-7-9-12(13)10-8-11/h7,9,11,13H,2-6,8,10H2,1H3/b13-12- |
| InChIKey | LTEWNLJHFJAOFY-SEYXRHQNSA-N |
| XLogP | 3.94 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|