C21H34N8O — CID 123355542
1-[4-[[8-(cyclopropylamino)imidazo[1,2-b]pyridazin-6-yl]amino]cyclohexyl]-3-[3-(dimethylamino)propyl]urea (PubChem CID 123355542) has the molecular formula C21H34N8O and a molecular weight of 414.56 g/mol. Its IUPAC name is 1-[4-[[8-(cyclopropylamino)imidazo[1,2-b]pyridazin-6-yl]amino]cyclohexyl]-3-[3-(dimethylamino)propyl]urea.
| Compound Name | 1-[4-[[8-(cyclopropylamino)imidazo[1,2-b]pyridazin-6-yl]amino]cyclohexyl]-3-[3-(dimethylamino)propyl]urea |
|---|---|
| PubChem CID | 123355542 |
| Molecular Formula | C21H34N8O |
| Molecular Weight | 414.56 g/mol |
| Exact Mass | 414.29 |
| IUPAC Name | 1-[4-[[8-(cyclopropylamino)imidazo[1,2-b]pyridazin-6-yl]amino]cyclohexyl]-3-[3-(dimethylamino)propyl]urea |
| SMILES | CN(C)CCCNC(=O)NC1CCC(Nc2cc(NC3CC3)c3nccn3n2)CC1 |
| InChI | InChI=1S/C21H34N8O/c1-28(2)12-3-10-23-21(30)26-17-8-6-16(7-9-17)25-19-14-18(24-15-4-5-15)20-22-11-13-29(20)27-19/h11,13-17,24H,3-10,12H2,1-2H3,(H,25,27)(H2,23,26,30) |
| InChIKey | ICZXABXUTNYRHK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 98.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.56 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|