C15H18F3N5O2 — CID 66691540
[6-(cyclopentylamino)imidazo[1,2-b]pyridazin-8-yl]-(3,3,3-trifluoropropyl)carbamic acid (PubChem CID 66691540) has the molecular formula C15H18F3N5O2 and a molecular weight of 357.34 g/mol. Its IUPAC name is [6-(cyclopentylamino)imidazo[1,2-b]pyridazin-8-yl]-(3,3,3-trifluoropropyl)carbamic acid.
| Compound Name | [6-(cyclopentylamino)imidazo[1,2-b]pyridazin-8-yl]-(3,3,3-trifluoropropyl)carbamic acid |
|---|---|
| PubChem CID | 66691540 |
| Molecular Formula | C15H18F3N5O2 |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | [6-(cyclopentylamino)imidazo[1,2-b]pyridazin-8-yl]-(3,3,3-trifluoropropyl)carbamic acid |
| SMILES | O=C(O)N(CCC(F)(F)F)c1cc(NC2CCCC2)nn2ccnc12 |
| InChI | InChI=1S/C15H18F3N5O2/c16-15(17,18)5-7-22(14(24)25)11-9-12(20-10-3-1-2-4-10)21-23-8-6-19-13(11)23/h6,8-10H,1-5,7H2,(H,20,21)(H,24,25) |
| InChIKey | JUIMHKPUFMIACB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|