C44H50N2+2 — CID 123357312
10-butyl-7,7-diethyl-6-[[2-[1-methyl-5-[3-(2-methylpropyl)phenyl]pyridin-1-ium-2-yl]phenyl]methylidene]benzo[a]quinolizin-5-ium (PubChem CID 123357312) has the molecular formula C44H50N2+2 and a molecular weight of 606.90 g/mol. Its IUPAC name is 10-butyl-7,7-diethyl-6-[[2-[1-methyl-5-[3-(2-methylpropyl)phenyl]pyridin-1-ium-2-yl]phenyl]methylidene]benzo[a]quinolizin-5-ium.
| Compound Name | 10-butyl-7,7-diethyl-6-[[2-[1-methyl-5-[3-(2-methylpropyl)phenyl]pyridin-1-ium-2-yl]phenyl]methylidene]benzo[a]quinolizin-5-ium |
|---|---|
| PubChem CID | 123357312 |
| Molecular Formula | C44H50N2+2 |
| Molecular Weight | 606.90 g/mol |
| Exact Mass | 606.40 |
| IUPAC Name | 10-butyl-7,7-diethyl-6-[[2-[1-methyl-5-[3-(2-methylpropyl)phenyl]pyridin-1-ium-2-yl]phenyl]methylidene]benzo[a]quinolizin-5-ium |
| SMILES | CCCCc1ccc2c(c1)-c1cccc[n+]1C(=Cc1ccccc1-c1ccc(-c3cccc(CC(C)C)c3)c[n+]1C)C2(CC)CC |
| InChI | InChI=1S/C44H50N2/c1-7-10-16-33-22-24-40-39(29-33)42-21-13-14-26-46(42)43(44(40,8-2)9-3)30-36-18-11-12-20-38(36)41-25-23-37(31-45(41)6)35-19-15-17-34(28-35)27-32(4)5/h11-15,17-26,28-32H,7-10,16,27H2,1-6H3/q+2 |
| InChIKey | NSVWPIKDMFREKU-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.90 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|