C13H14 — CID 123358834
2-methyl-1,2,3a,8b-tetrahydroacenaphthylene (PubChem CID 123358834) has the molecular formula C13H14 and a molecular weight of 170.25 g/mol. Its IUPAC name is 2-methyl-1,2,3a,8b-tetrahydroacenaphthylene.
| Compound Name | 2-methyl-1,2,3a,8b-tetrahydroacenaphthylene |
|---|---|
| PubChem CID | 123358834 |
| Molecular Formula | C13H14 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 2-methyl-1,2,3a,8b-tetrahydroacenaphthylene |
| SMILES | CC1CC2=CC=CC3=CC=CC1C32 |
| InChI | InChI=1S/C13H14/c1-9-8-11-6-2-4-10-5-3-7-12(9)13(10)11/h2-7,9,12-13H,8H2,1H3 |
| InChIKey | UEHRZNDTSZHZGM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |