C24H36 — CID 123567787
10b,10c-dihydropyrene;ethane (PubChem CID 123567787) has the molecular formula C24H36 and a molecular weight of 324.55 g/mol. Its IUPAC name is 10b,10c-dihydropyrene;ethane.
| Compound Name | 10b,10c-dihydropyrene;ethane |
|---|---|
| PubChem CID | 123567787 |
| Molecular Formula | C24H36 |
| Molecular Weight | 324.55 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | 10b,10c-dihydropyrene;ethane |
| SMILES | C1=CC2=CC=C3C=CC=C4C=CC(=C1)C2C43.CC.CC.CC.CC |
| InChI | InChI=1S/C16H12.4C2H6/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14;4*1-2/h1-10,15-16H;4*1-2H3 |
| InChIKey | WEXFMRNDWJBMQF-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.55 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |