C15H19N — CID 91595441
N-[1-(8-methyl-8,8a-dihydronaphthalen-1-yl)ethyl]ethanimine (PubChem CID 91595441) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is N-[1-(8-methyl-8,8a-dihydronaphthalen-1-yl)ethyl]ethanimine.
| Compound Name | N-[1-(8-methyl-8,8a-dihydronaphthalen-1-yl)ethyl]ethanimine |
|---|---|
| PubChem CID | 91595441 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | N-[1-(8-methyl-8,8a-dihydronaphthalen-1-yl)ethyl]ethanimine |
| SMILES | C/C=N/C(C)C1=CC=CC2=CC=CC(C)C21 |
| InChI | InChI=1S/C15H19N/c1-4-16-12(3)14-10-6-9-13-8-5-7-11(2)15(13)14/h4-12,15H,1-3H3/b16-4+ |
| InChIKey | XLMCJKFCQLBKTP-AYSLTRBKSA-N |
| XLogP | 3.71 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|