About 2-iodo-10b,10c-dihydropyrene
2-iodo-10b,10c-dihydropyrene (PubChem CID 138626052) has the molecular formula C16H11I
and a molecular weight of 330.17 g/mol. Its IUPAC name is 2-iodo-10b,10c-dihydropyrene.
Molecular Properties
| Compound Name | 2-iodo-10b,10c-dihydropyrene |
| PubChem CID | 138626052 |
| Molecular Formula | C16H11I |
| Molecular Weight | 330.17 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | 2-iodo-10b,10c-dihydropyrene |
| SMILES | IC1=CC2=CC=C3C=CC=C4C=CC(=C1)C2C43 |
| InChI | InChI=1S/C16H11I/c17-14-8-12-6-4-10-2-1-3-11-5-7-13(9-14)16(12)15(10)11/h1-9,15-16H |
| InChIKey | WUQROGQPZNCTMY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.17 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-iodo-10b,10c-dihydropyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodo-10b,10c-dihydropyrene?
The IUPAC name of 2-iodo-10b,10c-dihydropyrene (CID 138626052) is 2-iodo-10b,10c-dihydropyrene.
What is the SMILES notation for 2-iodo-10b,10c-dihydropyrene?
The canonical SMILES for 2-iodo-10b,10c-dihydropyrene is IC1=CC2=CC=C3C=CC=C4C=CC(=C1)C2C43.
What is the InChIKey of 2-iodo-10b,10c-dihydropyrene?
The InChIKey is WUQROGQPZNCTMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11I/c17-14-8-12-6-4-10-2-1-3-11-5-7-13(9-14)16(12)15(10)11/h1-9,15-16H.
What are the key properties of 2-iodo-10b,10c-dihydropyrene?
2-iodo-10b,10c-dihydropyrene has a molecular weight of 330.17 g/mol, XLogP of 4.41, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodo-10b,10c-dihydropyrene is sourced from PubChem (CID 138626052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).