C12H16N3+ — CID 123359022
2-(1-ethyl-1-methyl-5,6-dihydrobenzimidazol-1-ium-2-yl)acetonitrile (PubChem CID 123359022) has the molecular formula C12H16N3+ and a molecular weight of 202.28 g/mol. Its IUPAC name is 2-(1-ethyl-1-methyl-5,6-dihydrobenzimidazol-1-ium-2-yl)acetonitrile.
| Compound Name | 2-(1-ethyl-1-methyl-5,6-dihydrobenzimidazol-1-ium-2-yl)acetonitrile |
|---|---|
| PubChem CID | 123359022 |
| Molecular Formula | C12H16N3+ |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | 2-(1-ethyl-1-methyl-5,6-dihydrobenzimidazol-1-ium-2-yl)acetonitrile |
| SMILES | CC[N+]1(C)C2=CCCC=C2N=C1CC#N |
| InChI | InChI=1S/C12H16N3/c1-3-15(2)11-7-5-4-6-10(11)14-12(15)8-9-13/h6-7H,3-5,8H2,1-2H3/q+1 |
| InChIKey | PRSQFVPPGYDIPX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|