C23H26FN5O5S — CID 123362473
4-[2-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yloxy)-4-fluoroanilino]-N-(ethylidene-methyl-oxo-λ6-sulfanyl)-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxamide (PubChem CID 123362473) has the molecular formula C23H26FN5O5S and a molecular weight of 503.56 g/mol. Its IUPAC name is 4-[2-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yloxy)-4-fluoroanilino]-N-(ethylidene-methyl-oxo-λ6-sulfanyl)-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxamide.
| Compound Name | 4-[2-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yloxy)-4-fluoroanilino]-N-(ethylidene-methyl-oxo-λ6-sulfanyl)-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxamide |
|---|---|
| PubChem CID | 123362473 |
| Molecular Formula | C23H26FN5O5S |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | 4-[2-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yloxy)-4-fluoroanilino]-N-(ethylidene-methyl-oxo-λ6-sulfanyl)-5-methylpyrrolo[2,1-f][1,2,4]triazine-6-carboxamide |
| SMILES | CC=S(C)(=O)NC(=O)c1cn2ncnc(Nc3ccc(F)cc3OC3COC4CCOC43)c2c1C |
| InChI | InChI=1S/C23H26FN5O5S/c1-4-35(3,31)28-23(30)15-10-29-20(13(15)2)22(25-12-26-29)27-16-6-5-14(24)9-18(16)34-19-11-33-17-7-8-32-21(17)19/h4-6,9-10,12,17,19,21H,7-8,11H2,1-3H3,(H,25,26,27)(H,28,30,31) |
| InChIKey | PWEQIPDBKLYKDM-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|