C14H23N — CID 123362960
7-methyl-7-(2-methylcyclopropyl)-4-propan-2-yl-3,4-dihydroazepine (PubChem CID 123362960) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is 7-methyl-7-(2-methylcyclopropyl)-4-propan-2-yl-3,4-dihydroazepine.
| Compound Name | 7-methyl-7-(2-methylcyclopropyl)-4-propan-2-yl-3,4-dihydroazepine |
|---|---|
| PubChem CID | 123362960 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 7-methyl-7-(2-methylcyclopropyl)-4-propan-2-yl-3,4-dihydroazepine |
| SMILES | CC(C)C1C=CC(C)(C2CC2C)N=CC1 |
| InChI | InChI=1S/C14H23N/c1-10(2)12-5-7-14(4,15-8-6-12)13-9-11(13)3/h5,7-8,10-13H,6,9H2,1-4H3 |
| InChIKey | GEJYKQGESCJFOL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|