C14H23N — CID 123199977
3-ethenyl-4,5,6-trimethyl-2-prop-1-enyl-3,4,5,6-tetrahydro-2H-azepine (PubChem CID 123199977) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is 3-ethenyl-4,5,6-trimethyl-2-prop-1-enyl-3,4,5,6-tetrahydro-2H-azepine.
| Compound Name | 3-ethenyl-4,5,6-trimethyl-2-prop-1-enyl-3,4,5,6-tetrahydro-2H-azepine |
|---|---|
| PubChem CID | 123199977 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 3-ethenyl-4,5,6-trimethyl-2-prop-1-enyl-3,4,5,6-tetrahydro-2H-azepine |
| SMILES | C=CC1C(C=CC)N=CC(C)C(C)C1C |
| InChI | InChI=1S/C14H23N/c1-6-8-14-13(7-2)12(5)11(4)10(3)9-15-14/h6-14H,2H2,1,3-5H3 |
| InChIKey | YWXFVWLMMNRUFZ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|