C23H25NO3 — CID 123366407
1-imino-4-[1-(3-phenoxyphenyl)-2-oxabicyclo[2.2.2]octan-4-yl]butan-2-one (PubChem CID 123366407) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is 1-imino-4-[1-(3-phenoxyphenyl)-2-oxabicyclo[2.2.2]octan-4-yl]butan-2-one.
| Compound Name | 1-imino-4-[1-(3-phenoxyphenyl)-2-oxabicyclo[2.2.2]octan-4-yl]butan-2-one |
|---|---|
| PubChem CID | 123366407 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 1-imino-4-[1-(3-phenoxyphenyl)-2-oxabicyclo[2.2.2]octan-4-yl]butan-2-one |
| SMILES | [H]/N=C/C(=O)CCC12CCC(c3cccc(Oc4ccccc4)c3)(CC1)OC2 |
| InChI | InChI=1S/C23H25NO3/c24-16-19(25)9-10-22-11-13-23(14-12-22,26-17-22)18-5-4-8-21(15-18)27-20-6-2-1-3-7-20/h1-8,15-16,24H,9-14,17H2/b24-16+ |
| InChIKey | IKZUGEPYBKRNFC-LFVJCYFKSA-N |
| XLogP | 5.26 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|