C24H34O5 — CID 90409122
2-[2-[1-[3-(cyclohexylmethoxy)phenyl]-2-oxabicyclo[2.2.2]octan-4-yl]ethoxy]acetic acid (PubChem CID 90409122) has the molecular formula C24H34O5 and a molecular weight of 402.53 g/mol. Its IUPAC name is 2-[2-[1-[3-(cyclohexylmethoxy)phenyl]-2-oxabicyclo[2.2.2]octan-4-yl]ethoxy]acetic acid.
| Compound Name | 2-[2-[1-[3-(cyclohexylmethoxy)phenyl]-2-oxabicyclo[2.2.2]octan-4-yl]ethoxy]acetic acid |
|---|---|
| PubChem CID | 90409122 |
| Molecular Formula | C24H34O5 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | 2-[2-[1-[3-(cyclohexylmethoxy)phenyl]-2-oxabicyclo[2.2.2]octan-4-yl]ethoxy]acetic acid |
| SMILES | O=C(O)COCCC12CCC(c3cccc(OCC4CCCCC4)c3)(CC1)OC2 |
| InChI | InChI=1S/C24H34O5/c25-22(26)17-27-14-13-23-9-11-24(12-10-23,29-18-23)20-7-4-8-21(15-20)28-16-19-5-2-1-3-6-19/h4,7-8,15,19H,1-3,5-6,9-14,16-18H2,(H,25,26) |
| InChIKey | LCFFHZLJFSKQSL-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|