C24H32O5 — CID 123490440
2-[2-[6-[3-(cyclohexylmethoxy)phenyl]-5-oxatricyclo[4.2.0.01,3]octan-3-yl]ethoxy]acetic acid (PubChem CID 123490440) has the molecular formula C24H32O5 and a molecular weight of 400.52 g/mol. Its IUPAC name is 2-[2-[6-[3-(cyclohexylmethoxy)phenyl]-5-oxatricyclo[4.2.0.01,3]octan-3-yl]ethoxy]acetic acid.
| Compound Name | 2-[2-[6-[3-(cyclohexylmethoxy)phenyl]-5-oxatricyclo[4.2.0.01,3]octan-3-yl]ethoxy]acetic acid |
|---|---|
| PubChem CID | 123490440 |
| Molecular Formula | C24H32O5 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 2-[2-[6-[3-(cyclohexylmethoxy)phenyl]-5-oxatricyclo[4.2.0.01,3]octan-3-yl]ethoxy]acetic acid |
| SMILES | O=C(O)COCCC12COC3(c4cccc(OCC5CCCCC5)c4)CCC13C2 |
| InChI | InChI=1S/C24H32O5/c25-21(26)15-27-12-11-22-16-23(22)9-10-24(23,29-17-22)19-7-4-8-20(13-19)28-14-18-5-2-1-3-6-18/h4,7-8,13,18H,1-3,5-6,9-12,14-17H2,(H,25,26) |
| InChIKey | MUHFRCQOLISRQQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|