C24H30O4 — CID 90410674
(2S)-5-[1-(3-phenoxyphenyl)-2-oxabicyclo[2.2.2]octan-4-yl]pentane-1,2-diol (PubChem CID 90410674) has the molecular formula C24H30O4 and a molecular weight of 382.50 g/mol. Its IUPAC name is (2S)-5-[1-(3-phenoxyphenyl)-2-oxabicyclo[2.2.2]octan-4-yl]pentane-1,2-diol.
| Compound Name | (2S)-5-[1-(3-phenoxyphenyl)-2-oxabicyclo[2.2.2]octan-4-yl]pentane-1,2-diol |
|---|---|
| PubChem CID | 90410674 |
| Molecular Formula | C24H30O4 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | (2S)-5-[1-(3-phenoxyphenyl)-2-oxabicyclo[2.2.2]octan-4-yl]pentane-1,2-diol |
| SMILES | OC[C@@H](O)CCCC12CCC(c3cccc(Oc4ccccc4)c3)(CC1)OC2 |
| InChI | InChI=1S/C24H30O4/c25-17-20(26)7-5-11-23-12-14-24(15-13-23,27-18-23)19-6-4-10-22(16-19)28-21-8-2-1-3-9-21/h1-4,6,8-10,16,20,25-26H,5,7,11-15,17-18H2/t20-,23?,24?/m0/s1 |
| InChIKey | IPNBCFWJOCUJPD-XOYNAWAESA-N |
| XLogP | 4.79 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |