C18H14ClFN4O3S — CID 123368148
N-[3-chloro-4-(1-hydroxy-3-sulfanylidene-6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazin-2-yl)phenyl]-6-fluoropyridine-2-carboxamide (PubChem CID 123368148) has the molecular formula C18H14ClFN4O3S and a molecular weight of 420.85 g/mol. Its IUPAC name is N-[3-chloro-4-(1-hydroxy-3-sulfanylidene-6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazin-2-yl)phenyl]-6-fluoropyridine-2-carboxamide.
| Compound Name | N-[3-chloro-4-(1-hydroxy-3-sulfanylidene-6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazin-2-yl)phenyl]-6-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 123368148 |
| Molecular Formula | C18H14ClFN4O3S |
| Molecular Weight | 420.85 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | N-[3-chloro-4-(1-hydroxy-3-sulfanylidene-6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazin-2-yl)phenyl]-6-fluoropyridine-2-carboxamide |
| SMILES | O=C(Nc1ccc(-n2c(O)c3n(c2=S)CCOC3)c(Cl)c1)c1cccc(F)n1 |
| InChI | InChI=1S/C18H14ClFN4O3S/c19-11-8-10(21-16(25)12-2-1-3-15(20)22-12)4-5-13(11)24-17(26)14-9-27-7-6-23(14)18(24)28/h1-5,8,26H,6-7,9H2,(H,21,25) |
| InChIKey | ZECYMZGIKKCCJB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.85 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|