C22H25N5O5S — CID 123369102
4-(2-methylmorpholin-4-yl)-2-[6-(3-methylsulfonylpropoxy)imidazo[1,2-b]pyridazin-3-yl]furo[3,2-c]pyridine (PubChem CID 123369102) has the molecular formula C22H25N5O5S and a molecular weight of 471.54 g/mol. Its IUPAC name is 4-(2-methylmorpholin-4-yl)-2-[6-(3-methylsulfonylpropoxy)imidazo[1,2-b]pyridazin-3-yl]furo[3,2-c]pyridine.
| Compound Name | 4-(2-methylmorpholin-4-yl)-2-[6-(3-methylsulfonylpropoxy)imidazo[1,2-b]pyridazin-3-yl]furo[3,2-c]pyridine |
|---|---|
| PubChem CID | 123369102 |
| Molecular Formula | C22H25N5O5S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | 4-(2-methylmorpholin-4-yl)-2-[6-(3-methylsulfonylpropoxy)imidazo[1,2-b]pyridazin-3-yl]furo[3,2-c]pyridine |
| SMILES | CC1CN(c2nccc3oc(-c4cnc5ccc(OCCCS(C)(=O)=O)nn45)cc23)CCO1 |
| InChI | InChI=1S/C22H25N5O5S/c1-15-14-26(8-10-30-15)22-16-12-19(32-18(16)6-7-23-22)17-13-24-20-4-5-21(25-27(17)20)31-9-3-11-33(2,28)29/h4-7,12-13,15H,3,8-11,14H2,1-2H3 |
| InChIKey | BKLUJMWNMWMRSN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 112.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|