C22H26N6O4S — CID 78324492
4-[(3S)-3-methylpiperazin-1-yl]-2-[6-(3-methylsulfonylpropoxy)imidazo[1,2-b]pyridazin-3-yl]furo[3,2-c]pyridine (PubChem CID 78324492) has the molecular formula C22H26N6O4S and a molecular weight of 470.56 g/mol. Its IUPAC name is 4-[(3S)-3-methylpiperazin-1-yl]-2-[6-(3-methylsulfonylpropoxy)imidazo[1,2-b]pyridazin-3-yl]furo[3,2-c]pyridine.
| Compound Name | 4-[(3S)-3-methylpiperazin-1-yl]-2-[6-(3-methylsulfonylpropoxy)imidazo[1,2-b]pyridazin-3-yl]furo[3,2-c]pyridine |
|---|---|
| PubChem CID | 78324492 |
| Molecular Formula | C22H26N6O4S |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 4-[(3S)-3-methylpiperazin-1-yl]-2-[6-(3-methylsulfonylpropoxy)imidazo[1,2-b]pyridazin-3-yl]furo[3,2-c]pyridine |
| SMILES | C[C@H]1CN(c2nccc3oc(-c4cnc5ccc(OCCCS(C)(=O)=O)nn45)cc23)CCN1 |
| InChI | InChI=1S/C22H26N6O4S/c1-15-14-27(9-8-23-15)22-16-12-19(32-18(16)6-7-24-22)17-13-25-20-4-5-21(26-28(17)20)31-10-3-11-33(2,29)30/h4-7,12-13,15,23H,3,8-11,14H2,1-2H3/t15-/m0/s1 |
| InChIKey | GTWFPSFQVIOTIF-HNNXBMFYSA-N |
| XLogP | 2.15 |
| TPSA | 114.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|