C23H27N5O3S — CID 90368885
3-[4-[(3S)-3-methylpiperazin-1-yl]-1-benzofuran-2-yl]-6-(3-methylsulfinylpropoxy)imidazo[1,2-b]pyridazine (PubChem CID 90368885) has the molecular formula C23H27N5O3S and a molecular weight of 453.57 g/mol. Its IUPAC name is 3-[4-[(3S)-3-methylpiperazin-1-yl]-1-benzofuran-2-yl]-6-(3-methylsulfinylpropoxy)imidazo[1,2-b]pyridazine.
| Compound Name | 3-[4-[(3S)-3-methylpiperazin-1-yl]-1-benzofuran-2-yl]-6-(3-methylsulfinylpropoxy)imidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 90368885 |
| Molecular Formula | C23H27N5O3S |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 3-[4-[(3S)-3-methylpiperazin-1-yl]-1-benzofuran-2-yl]-6-(3-methylsulfinylpropoxy)imidazo[1,2-b]pyridazine |
| SMILES | C[C@H]1CN(c2cccc3oc(-c4cnc5ccc(OCCCS(C)=O)nn45)cc23)CCN1 |
| InChI | InChI=1S/C23H27N5O3S/c1-16-15-27(10-9-24-16)18-5-3-6-20-17(18)13-21(31-20)19-14-25-22-7-8-23(26-28(19)22)30-11-4-12-32(2)29/h3,5-8,13-14,16,24H,4,9-12,15H2,1-2H3/t16-,32?/m0/s1 |
| InChIKey | HJKIFMDUVQTZFF-KXJSNILUSA-N |
| XLogP | 3.09 |
| TPSA | 84.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|