C27H24F5N3S — CID 123369570
5-[4-(1,2-difluorohex-1-enyl)-2-fluorophenyl]-2-[4-(3,5-difluoro-4-isothiocyanatophenyl)butyl]pyrimidine (PubChem CID 123369570) has the molecular formula C27H24F5N3S and a molecular weight of 517.57 g/mol. Its IUPAC name is 5-[4-(1,2-difluorohex-1-enyl)-2-fluorophenyl]-2-[4-(3,5-difluoro-4-isothiocyanatophenyl)butyl]pyrimidine.
| Compound Name | 5-[4-(1,2-difluorohex-1-enyl)-2-fluorophenyl]-2-[4-(3,5-difluoro-4-isothiocyanatophenyl)butyl]pyrimidine |
|---|---|
| PubChem CID | 123369570 |
| Molecular Formula | C27H24F5N3S |
| Molecular Weight | 517.57 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | 5-[4-(1,2-difluorohex-1-enyl)-2-fluorophenyl]-2-[4-(3,5-difluoro-4-isothiocyanatophenyl)butyl]pyrimidine |
| SMILES | CCCCC(F)=C(F)c1ccc(-c2cnc(CCCCc3cc(F)c(N=C=S)c(F)c3)nc2)c(F)c1 |
| InChI | InChI=1S/C27H24F5N3S/c1-2-3-7-21(28)26(32)18-9-10-20(22(29)13-18)19-14-33-25(34-15-19)8-5-4-6-17-11-23(30)27(35-16-36)24(31)12-17/h9-15H,2-8H2,1H3 |
| InChIKey | RFUNUDMNLVZCHG-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.57 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|