C27H16F7N — CID 123532911
5-[4-[4-(1,2-difluorobut-1-enyl)-2-fluorophenyl]-2-fluorophenyl]-2-(3,4,5-trifluorophenyl)pyridine (PubChem CID 123532911) has the molecular formula C27H16F7N and a molecular weight of 487.42 g/mol. Its IUPAC name is 5-[4-[4-(1,2-difluorobut-1-enyl)-2-fluorophenyl]-2-fluorophenyl]-2-(3,4,5-trifluorophenyl)pyridine.
| Compound Name | 5-[4-[4-(1,2-difluorobut-1-enyl)-2-fluorophenyl]-2-fluorophenyl]-2-(3,4,5-trifluorophenyl)pyridine |
|---|---|
| PubChem CID | 123532911 |
| Molecular Formula | C27H16F7N |
| Molecular Weight | 487.42 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 5-[4-[4-(1,2-difluorobut-1-enyl)-2-fluorophenyl]-2-fluorophenyl]-2-(3,4,5-trifluorophenyl)pyridine |
| SMILES | CCC(F)=C(F)c1ccc(-c2ccc(-c3ccc(-c4cc(F)c(F)c(F)c4)nc3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C27H16F7N/c1-2-20(28)26(33)15-4-7-18(22(30)10-15)14-3-6-19(21(29)9-14)16-5-8-25(35-13-16)17-11-23(31)27(34)24(32)12-17/h3-13H,2H2,1H3 |
| InChIKey | XIPMFYYYUZZRDA-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.42 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|