C32H21F7 — CID 123794846
5-[4-[4-[2-[4-(1,2-difluorohexa-1,3-dienyl)phenyl]ethenyl]-2-fluorophenyl]-2-fluorophenyl]-1,2,3-trifluorobenzene (PubChem CID 123794846) has the molecular formula C32H21F7 and a molecular weight of 538.51 g/mol. Its IUPAC name is 5-[4-[4-[2-[4-(1,2-difluorohexa-1,3-dienyl)phenyl]ethenyl]-2-fluorophenyl]-2-fluorophenyl]-1,2,3-trifluorobenzene.
| Compound Name | 5-[4-[4-[2-[4-(1,2-difluorohexa-1,3-dienyl)phenyl]ethenyl]-2-fluorophenyl]-2-fluorophenyl]-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 123794846 |
| Molecular Formula | C32H21F7 |
| Molecular Weight | 538.51 g/mol |
| Exact Mass | 538.15 |
| IUPAC Name | 5-[4-[4-[2-[4-(1,2-difluorohexa-1,3-dienyl)phenyl]ethenyl]-2-fluorophenyl]-2-fluorophenyl]-1,2,3-trifluorobenzene |
| SMILES | CCC=CC(F)=C(F)c1ccc(C=Cc2ccc(-c3ccc(-c4cc(F)c(F)c(F)c4)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C32H21F7/c1-2-3-4-26(33)31(38)21-10-7-19(8-11-21)5-6-20-9-13-24(27(34)15-20)22-12-14-25(28(35)16-22)23-17-29(36)32(39)30(37)18-23/h3-18H,2H2,1H3 |
| InChIKey | WJSXCJWOSHXTBK-UHFFFAOYSA-N |
| XLogP | 10.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.51 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|