C25H20F4 — CID 123834454
1,2,3-trifluoro-5-[2-fluoro-4-[4-(5-methylhexa-2,4-dien-2-yl)phenyl]phenyl]benzene (PubChem CID 123834454) has the molecular formula C25H20F4 and a molecular weight of 396.43 g/mol. Its IUPAC name is 1,2,3-trifluoro-5-[2-fluoro-4-[4-(5-methylhexa-2,4-dien-2-yl)phenyl]phenyl]benzene.
| Compound Name | 1,2,3-trifluoro-5-[2-fluoro-4-[4-(5-methylhexa-2,4-dien-2-yl)phenyl]phenyl]benzene |
|---|---|
| PubChem CID | 123834454 |
| Molecular Formula | C25H20F4 |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 1,2,3-trifluoro-5-[2-fluoro-4-[4-(5-methylhexa-2,4-dien-2-yl)phenyl]phenyl]benzene |
| SMILES | CC(C)=CC=C(C)c1ccc(-c2ccc(-c3cc(F)c(F)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C25H20F4/c1-15(2)4-5-16(3)17-6-8-18(9-7-17)19-10-11-21(22(26)12-19)20-13-23(27)25(29)24(28)14-20/h4-14H,1-3H3 |
| InChIKey | GSVROZGDZYSERM-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|