C30H20F6 — CID 123182329
5-[4-[4-[4-(1,2-difluorohexa-1,5-dienyl)phenyl]phenyl]-2-fluorophenyl]-1,2,3-trifluorobenzene (PubChem CID 123182329) has the molecular formula C30H20F6 and a molecular weight of 494.48 g/mol. Its IUPAC name is 5-[4-[4-[4-(1,2-difluorohexa-1,5-dienyl)phenyl]phenyl]-2-fluorophenyl]-1,2,3-trifluorobenzene.
| Compound Name | 5-[4-[4-[4-(1,2-difluorohexa-1,5-dienyl)phenyl]phenyl]-2-fluorophenyl]-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 123182329 |
| Molecular Formula | C30H20F6 |
| Molecular Weight | 494.48 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | 5-[4-[4-[4-(1,2-difluorohexa-1,5-dienyl)phenyl]phenyl]-2-fluorophenyl]-1,2,3-trifluorobenzene |
| SMILES | C=CCCC(F)=C(F)c1ccc(-c2ccc(-c3ccc(-c4cc(F)c(F)c(F)c4)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C30H20F6/c1-2-3-4-25(31)29(35)21-11-9-19(10-12-21)18-5-7-20(8-6-18)22-13-14-24(26(32)15-22)23-16-27(33)30(36)28(34)17-23/h2,5-17H,1,3-4H2 |
| InChIKey | VTVOOFPAXIDTJL-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.48 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|