C31H19ClF8O — CID 123558848
2-chloro-5-[4-[[4-[4-(1,2-difluorohexa-1,5-dienyl)phenyl]-2,6-difluorophenyl]-difluoromethoxy]phenyl]-1,3-difluorobenzene (PubChem CID 123558848) has the molecular formula C31H19ClF8O and a molecular weight of 594.93 g/mol. Its IUPAC name is 2-chloro-5-[4-[[4-[4-(1,2-difluorohexa-1,5-dienyl)phenyl]-2,6-difluorophenyl]-difluoromethoxy]phenyl]-1,3-difluorobenzene.
| Compound Name | 2-chloro-5-[4-[[4-[4-(1,2-difluorohexa-1,5-dienyl)phenyl]-2,6-difluorophenyl]-difluoromethoxy]phenyl]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 123558848 |
| Molecular Formula | C31H19ClF8O |
| Molecular Weight | 594.93 g/mol |
| Exact Mass | 594.10 |
| IUPAC Name | 2-chloro-5-[4-[[4-[4-(1,2-difluorohexa-1,5-dienyl)phenyl]-2,6-difluorophenyl]-difluoromethoxy]phenyl]-1,3-difluorobenzene |
| SMILES | C=CCCC(F)=C(F)c1ccc(-c2cc(F)c(C(F)(F)Oc3ccc(-c4cc(F)c(Cl)c(F)c4)cc3)c(F)c2)cc1 |
| InChI | InChI=1S/C31H19ClF8O/c1-2-3-4-23(33)30(38)19-7-5-17(6-8-19)20-13-24(34)28(25(35)14-20)31(39,40)41-22-11-9-18(10-12-22)21-15-26(36)29(32)27(37)16-21/h2,5-16H,1,3-4H2 |
| InChIKey | FOPAEPLSKUTQEM-UHFFFAOYSA-N |
| XLogP | 10.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.93 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|