C39H28Cl2F8O — CID 59583233
1-chloro-2-[4-(4-chloro-3,5-difluorophenyl)-3-fluorophenyl]-5-[[2,6-difluoro-4-(4-oct-7-enylphenyl)phenyl]-difluoromethoxy]-3-fluorobenzene (PubChem CID 59583233) has the molecular formula C39H28Cl2F8O and a molecular weight of 735.54 g/mol. Its IUPAC name is 1-chloro-2-[4-(4-chloro-3,5-difluorophenyl)-3-fluorophenyl]-5-[[2,6-difluoro-4-(4-oct-7-enylphenyl)phenyl]-difluoromethoxy]-3-fluorobenzene.
| Compound Name | 1-chloro-2-[4-(4-chloro-3,5-difluorophenyl)-3-fluorophenyl]-5-[[2,6-difluoro-4-(4-oct-7-enylphenyl)phenyl]-difluoromethoxy]-3-fluorobenzene |
|---|---|
| PubChem CID | 59583233 |
| Molecular Formula | C39H28Cl2F8O |
| Molecular Weight | 735.54 g/mol |
| Exact Mass | 734.14 |
| IUPAC Name | 1-chloro-2-[4-(4-chloro-3,5-difluorophenyl)-3-fluorophenyl]-5-[[2,6-difluoro-4-(4-oct-7-enylphenyl)phenyl]-difluoromethoxy]-3-fluorobenzene |
| SMILES | C=CCCCCCCc1ccc(-c2cc(F)c(C(F)(F)Oc3cc(F)c(-c4ccc(-c5cc(F)c(Cl)c(F)c5)c(F)c4)c(Cl)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C39H28Cl2F8O/c1-2-3-4-5-6-7-8-22-9-11-23(12-10-22)25-16-32(44)37(33(45)17-25)39(48,49)50-27-20-29(40)36(31(43)21-27)24-13-14-28(30(42)15-24)26-18-34(46)38(41)35(47)19-26/h2,9-21H,1,3-8H2 |
| InChIKey | BOMNLWPASNENOW-UHFFFAOYSA-N |
| XLogP | 13.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.54 |
| LogP ≤ 5 | 13.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|