C38H36F10O — CID 123982699
5-[4-(1,2-difluorohepta-1,5-dienyl)-2-fluorophenyl]-2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]cyclohexyl]cyclohexyl]-1,3-difluorobenzene (PubChem CID 123982699) has the molecular formula C38H36F10O and a molecular weight of 698.69 g/mol. Its IUPAC name is 5-[4-(1,2-difluorohepta-1,5-dienyl)-2-fluorophenyl]-2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]cyclohexyl]cyclohexyl]-1,3-difluorobenzene.
| Compound Name | 5-[4-(1,2-difluorohepta-1,5-dienyl)-2-fluorophenyl]-2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]cyclohexyl]cyclohexyl]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 123982699 |
| Molecular Formula | C38H36F10O |
| Molecular Weight | 698.69 g/mol |
| Exact Mass | 698.26 |
| IUPAC Name | 5-[4-(1,2-difluorohepta-1,5-dienyl)-2-fluorophenyl]-2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]cyclohexyl]cyclohexyl]-1,3-difluorobenzene |
| SMILES | CC=CCCC(F)=C(F)c1ccc(-c2cc(F)c(C3CCC(C4CCC(C(F)(F)Oc5cc(F)c(F)c(F)c5)CC4)CC3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C38H36F10O/c1-2-3-4-5-29(39)36(45)24-12-15-28(30(40)16-24)25-17-31(41)35(32(42)18-25)23-8-6-21(7-9-23)22-10-13-26(14-11-22)38(47,48)49-27-19-33(43)37(46)34(44)20-27/h2-3,12,15-23,26H,4-11,13-14H2,1H3 |
| InChIKey | JIMZAONSJPVWDB-UHFFFAOYSA-N |
| XLogP | 12.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.69 |
| LogP ≤ 5 | 12.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|