C30H34F6O — CID 123838259
2-but-3-enyl-5-[[4-[4-(1,2-difluorohept-1-enyl)phenyl]cyclohexyl]-difluoromethoxy]-1,3-difluorobenzene (PubChem CID 123838259) has the molecular formula C30H34F6O and a molecular weight of 524.59 g/mol. Its IUPAC name is 2-but-3-enyl-5-[[4-[4-(1,2-difluorohept-1-enyl)phenyl]cyclohexyl]-difluoromethoxy]-1,3-difluorobenzene.
| Compound Name | 2-but-3-enyl-5-[[4-[4-(1,2-difluorohept-1-enyl)phenyl]cyclohexyl]-difluoromethoxy]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 123838259 |
| Molecular Formula | C30H34F6O |
| Molecular Weight | 524.59 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | 2-but-3-enyl-5-[[4-[4-(1,2-difluorohept-1-enyl)phenyl]cyclohexyl]-difluoromethoxy]-1,3-difluorobenzene |
| SMILES | C=CCCc1c(F)cc(OC(F)(F)C2CCC(c3ccc(C(F)=C(F)CCCCC)cc3)CC2)cc1F |
| InChI | InChI=1S/C30H34F6O/c1-3-5-7-9-26(31)29(34)22-12-10-20(11-13-22)21-14-16-23(17-15-21)30(35,36)37-24-18-27(32)25(8-6-4-2)28(33)19-24/h4,10-13,18-19,21,23H,2-3,5-9,14-17H2,1H3 |
| InChIKey | RXFCCARBGQWBLC-UHFFFAOYSA-N |
| XLogP | 10.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.59 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|