C35H39F9O2 — CID 123753535
5-[2-[4-(1,2-difluorohept-1-enyl)-2,6-difluorophenyl]ethyl]-2-[2-[4-[3,5-difluoro-4-(trifluoromethoxy)phenyl]cyclohexyl]ethenyl]oxane (PubChem CID 123753535) has the molecular formula C35H39F9O2 and a molecular weight of 662.68 g/mol. Its IUPAC name is 5-[2-[4-(1,2-difluorohept-1-enyl)-2,6-difluorophenyl]ethyl]-2-[2-[4-[3,5-difluoro-4-(trifluoromethoxy)phenyl]cyclohexyl]ethenyl]oxane.
| Compound Name | 5-[2-[4-(1,2-difluorohept-1-enyl)-2,6-difluorophenyl]ethyl]-2-[2-[4-[3,5-difluoro-4-(trifluoromethoxy)phenyl]cyclohexyl]ethenyl]oxane |
|---|---|
| PubChem CID | 123753535 |
| Molecular Formula | C35H39F9O2 |
| Molecular Weight | 662.68 g/mol |
| Exact Mass | 662.28 |
| IUPAC Name | 5-[2-[4-(1,2-difluorohept-1-enyl)-2,6-difluorophenyl]ethyl]-2-[2-[4-[3,5-difluoro-4-(trifluoromethoxy)phenyl]cyclohexyl]ethenyl]oxane |
| SMILES | CCCCCC(F)=C(F)c1cc(F)c(CCC2CCC(C=CC3CCC(c4cc(F)c(OC(F)(F)F)c(F)c4)CC3)OC2)c(F)c1 |
| InChI | InChI=1S/C35H39F9O2/c1-2-3-4-5-28(36)33(41)25-18-29(37)27(30(38)19-25)15-10-22-9-14-26(45-20-22)13-8-21-6-11-23(12-7-21)24-16-31(39)34(32(40)17-24)46-35(42,43)44/h8,13,16-19,21-23,26H,2-7,9-12,14-15,20H2,1H3 |
| InChIKey | SFCSCTRTAMCAJJ-UHFFFAOYSA-N |
| XLogP | 11.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.68 |
| LogP ≤ 5 | 11.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|