C37H35F5 — CID 123698965
5-[4-[4-[2-[4-(1,2-difluoroprop-1-enyl)phenyl]ethyl]phenyl]-2-fluorophenyl]-1,3-difluoro-2-oct-7-enylbenzene (PubChem CID 123698965) has the molecular formula C37H35F5 and a molecular weight of 574.68 g/mol. Its IUPAC name is 5-[4-[4-[2-[4-(1,2-difluoroprop-1-enyl)phenyl]ethyl]phenyl]-2-fluorophenyl]-1,3-difluoro-2-oct-7-enylbenzene.
| Compound Name | 5-[4-[4-[2-[4-(1,2-difluoroprop-1-enyl)phenyl]ethyl]phenyl]-2-fluorophenyl]-1,3-difluoro-2-oct-7-enylbenzene |
|---|---|
| PubChem CID | 123698965 |
| Molecular Formula | C37H35F5 |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.27 |
| IUPAC Name | 5-[4-[4-[2-[4-(1,2-difluoroprop-1-enyl)phenyl]ethyl]phenyl]-2-fluorophenyl]-1,3-difluoro-2-oct-7-enylbenzene |
| SMILES | C=CCCCCCCc1c(F)cc(-c2ccc(-c3ccc(CCc4ccc(C(F)=C(C)F)cc4)cc3)cc2F)cc1F |
| InChI | InChI=1S/C37H35F5/c1-3-4-5-6-7-8-9-33-35(40)23-31(24-36(33)41)32-21-20-30(22-34(32)39)28-16-12-26(13-17-28)10-11-27-14-18-29(19-15-27)37(42)25(2)38/h3,12-24H,1,4-11H2,2H3 |
| InChIKey | RQLWQINEQUFRLV-UHFFFAOYSA-N |
| XLogP | 11.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | 11.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|