C27H28F2 — CID 158187242
4-(4-butylphenyl)-2-fluoro-1-[4-[(Z)-4-fluoropent-3-enyl]phenyl]benzene (PubChem CID 158187242) has the molecular formula C27H28F2 and a molecular weight of 390.52 g/mol. Its IUPAC name is 4-(4-butylphenyl)-2-fluoro-1-[4-[(Z)-4-fluoropent-3-enyl]phenyl]benzene.
| Compound Name | 4-(4-butylphenyl)-2-fluoro-1-[4-[(Z)-4-fluoropent-3-enyl]phenyl]benzene |
|---|---|
| PubChem CID | 158187242 |
| Molecular Formula | C27H28F2 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 4-(4-butylphenyl)-2-fluoro-1-[4-[(Z)-4-fluoropent-3-enyl]phenyl]benzene |
| SMILES | CCCCc1ccc(-c2ccc(-c3ccc(CC/C=C(/C)F)cc3)c(F)c2)cc1 |
| InChI | InChI=1S/C27H28F2/c1-3-4-7-21-9-13-23(14-10-21)25-17-18-26(27(29)19-25)24-15-11-22(12-16-24)8-5-6-20(2)28/h6,9-19H,3-5,7-8H2,1-2H3/b20-6- |
| InChIKey | RVYCJFDOIUJURI-IOXNKQMXSA-N |
| XLogP | 8.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |