C28H32FP — CID 142376956
[(E)-5-[4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]pent-2-en-2-yl]phosphane (PubChem CID 142376956) has the molecular formula C28H32FP and a molecular weight of 418.54 g/mol. Its IUPAC name is [(E)-5-[4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]pent-2-en-2-yl]phosphane.
| Compound Name | [(E)-5-[4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]pent-2-en-2-yl]phosphane |
|---|---|
| PubChem CID | 142376956 |
| Molecular Formula | C28H32FP |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | [(E)-5-[4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]pent-2-en-2-yl]phosphane |
| SMILES | CCCCCc1ccc(-c2ccc(-c3ccc(CC/C=C(\C)P)cc3)c(F)c2)cc1 |
| InChI | InChI=1S/C28H32FP/c1-3-4-5-8-22-10-14-24(15-11-22)26-18-19-27(28(29)20-26)25-16-12-23(13-17-25)9-6-7-21(2)30/h7,10-20H,3-6,8-9,30H2,1-2H3/b21-7+ |
| InChIKey | RKINYIIJOPCBQO-QPSGOUHRSA-N |
| XLogP | 8.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|